C39H54N2O7 — CID 23644803
1-phenylnon-8-enyl N-[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-hex-5-enylcarbamate (PubChem CID 23644803) has the molecular formula C39H54N2O7 and a molecular weight of 662.87 g/mol. Its IUPAC name is 1-phenylnon-8-enyl N-[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-hex-5-enylcarbamate.
| Compound Name | 1-phenylnon-8-enyl N-[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-hex-5-enylcarbamate |
|---|---|
| PubChem CID | 23644803 |
| Molecular Formula | C39H54N2O7 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | 1-phenylnon-8-enyl N-[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-hex-5-enylcarbamate |
| SMILES | C=CCCCCCCC(OC(=O)N(CCCCC=C)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C39H54N2O7/c1-3-5-7-9-10-17-23-35(31-21-15-12-16-22-31)48-39(44)41(25-18-8-6-4-2)28-34(42)33(27-30-19-13-11-14-20-30)40-38(43)47-36-29-46-37-32(36)24-26-45-37/h3-4,11-16,19-22,32-37,42H,1-2,5-10,17-18,23-29H2,(H,40,43)/t32-,33-,34+,35?,36-,37+/m0/s1 |
| InChIKey | BDGQCSMKPSGIHW-CXFRYXSWSA-N |
| XLogP | 7.51 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|