C23H19N3O2S — CID 23644856
N-(4-phenoxyphenyl)-4-(2-pyridin-4-ylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 23644856) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-4-(2-pyridin-4-ylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-phenoxyphenyl)-4-(2-pyridin-4-ylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 23644856 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(4-phenoxyphenyl)-4-(2-pyridin-4-ylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1scnc1CCc1ccncc1 |
| InChI | InChI=1S/C23H19N3O2S/c27-23(22-21(25-16-29-22)11-6-17-12-14-24-15-13-17)26-18-7-9-20(10-8-18)28-19-4-2-1-3-5-19/h1-5,7-10,12-16H,6,11H2,(H,26,27) |
| InChIKey | HDOCUDLZEJKKPA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |