C21H28O3 — CID 23645029
(10R,13S)-10-(2-methoxyethyl)-13-methyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 23645029) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (10R,13S)-10-(2-methoxyethyl)-13-methyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (10R,13S)-10-(2-methoxyethyl)-13-methyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 23645029 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (10R,13S)-10-(2-methoxyethyl)-13-methyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COCC[C@]12CCC(=O)C=C1CCC1C2=CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C21H28O3/c1-20-9-8-18-16(17(20)5-6-19(20)23)4-3-14-13-15(22)7-10-21(14,18)11-12-24-2/h8,13,16-17H,3-7,9-12H2,1-2H3/t16?,17?,20-,21+/m0/s1 |
| InChIKey | SQXJYNCVTMWQFT-ZHAWHOEGSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|