C26H30O2Se — CID 23645032
(10R,13S)-13-methyl-10-(2-phenylselanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 23645032) has the molecular formula C26H30O2Se and a molecular weight of 453.48 g/mol. Its IUPAC name is (10R,13S)-13-methyl-10-(2-phenylselanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (10R,13S)-13-methyl-10-(2-phenylselanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 23645032 |
| Molecular Formula | C26H30O2Se |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (10R,13S)-13-methyl-10-(2-phenylselanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC=C3C(CCC4=CC(=O)CC[C@@]43CC[Se]c3ccccc3)C1CCC2=O |
| InChI | InChI=1S/C26H30O2Se/c1-25-13-12-23-21(22(25)9-10-24(25)28)8-7-18-17-19(27)11-14-26(18,23)15-16-29-20-5-3-2-4-6-20/h2-6,12,17,21-22H,7-11,13-16H2,1H3/t21?,22?,25-,26+/m0/s1 |
| InChIKey | YWTWQSPOEDGZOS-BDBAHPOVSA-N |
| XLogP | 4.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|