About methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate
methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate (PubChem CID 23645151) has the molecular formula C16H13FN2O4
and a molecular weight of 316.29 g/mol. Its IUPAC name is methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate |
| PubChem CID | 23645151 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate |
| SMILES | COC(=O)CCN1C(=O)c2c(C)nc3ccc(F)cc3c2C1=O |
| InChI | InChI=1S/C16H13FN2O4/c1-8-13-14(10-7-9(17)3-4-11(10)18-8)16(22)19(15(13)21)6-5-12(20)23-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ZRLPRPSPBJMCES-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate?
The IUPAC name of methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate (CID 23645151) is methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate.
What is the SMILES notation for methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate?
The canonical SMILES for methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate is COC(=O)CCN1C(=O)c2c(C)nc3ccc(F)cc3c2C1=O.
What is the InChIKey of methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate?
The InChIKey is ZRLPRPSPBJMCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O4/c1-8-13-14(10-7-9(17)3-4-11(10)18-8)16(22)19(15(13)21)6-5-12(20)23-2/h3-4,7H,5-6H2,1-2H3.
What are the key properties of methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate?
methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate has a molecular weight of 316.29 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(8-fluoro-4-methyl-1,3-dioxopyrrolo[3,4-c]quinolin-2-yl)propanoate is sourced from PubChem (CID 23645151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).