About N,N'-dipyridin-4-ylnonane-1,9-diamine
N,N'-dipyridin-4-ylnonane-1,9-diamine (PubChem CID 23645212) has the molecular formula C19H28N4
and a molecular weight of 312.46 g/mol. Its IUPAC name is N,N'-dipyridin-4-ylnonane-1,9-diamine.
Molecular Properties
| Compound Name | N,N'-dipyridin-4-ylnonane-1,9-diamine |
| PubChem CID | 23645212 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N,N'-dipyridin-4-ylnonane-1,9-diamine |
| SMILES | c1cc(NCCCCCCCCCNc2ccncc2)ccn1 |
| InChI | InChI=1S/C19H28N4/c1(2-4-6-12-22-18-8-14-20-15-9-18)3-5-7-13-23-19-10-16-21-17-11-19/h8-11,14-17H,1-7,12-13H2,(H,20,22)(H,21,23) |
| InChIKey | LINLRTMCHWNVKL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dipyridin-4-ylnonane-1,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dipyridin-4-ylnonane-1,9-diamine?
The IUPAC name of N,N'-dipyridin-4-ylnonane-1,9-diamine (CID 23645212) is N,N'-dipyridin-4-ylnonane-1,9-diamine.
What is the SMILES notation for N,N'-dipyridin-4-ylnonane-1,9-diamine?
The canonical SMILES for N,N'-dipyridin-4-ylnonane-1,9-diamine is c1cc(NCCCCCCCCCNc2ccncc2)ccn1.
What is the InChIKey of N,N'-dipyridin-4-ylnonane-1,9-diamine?
The InChIKey is LINLRTMCHWNVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4/c1(2-4-6-12-22-18-8-14-20-15-9-18)3-5-7-13-23-19-10-16-21-17-11-19/h8-11,14-17H,1-7,12-13H2,(H,20,22)(H,21,23).
What are the key properties of N,N'-dipyridin-4-ylnonane-1,9-diamine?
N,N'-dipyridin-4-ylnonane-1,9-diamine has a molecular weight of 312.46 g/mol, XLogP of 4.73, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dipyridin-4-ylnonane-1,9-diamine is sourced from PubChem (CID 23645212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).