C16H20ClN3 — CID 23645224
N'-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine (PubChem CID 23645224) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is N'-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine.
| Compound Name | N'-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 23645224 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N'-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine |
| SMILES | NCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C16H20ClN3/c17-11-6-7-13-15(10-11)20-14-5-2-1-4-12(14)16(13)19-9-3-8-18/h6-7,10H,1-5,8-9,18H2,(H,19,20) |
| InChIKey | FPBUGSBZFOFWAX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|