C14H13F9N2O4S — CID 23645528
2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide (PubChem CID 23645528) has the molecular formula C14H13F9N2O4S and a molecular weight of 476.32 g/mol. Its IUPAC name is 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide.
| Compound Name | 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23645528 |
| Molecular Formula | C14H13F9N2O4S |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F9N2O4S/c1-8(10(26)24-27)25(7-9-5-3-2-4-6-9)30(28,29)14(22,23)12(17,18)11(15,16)13(19,20)21/h2-6,8,27H,7H2,1H3,(H,24,26) |
| InChIKey | IWTGCCHOUSDKHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|