C16H17F9N2O4S — CID 23645531
2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxy-3-methylbutanamide (PubChem CID 23645531) has the molecular formula C16H17F9N2O4S and a molecular weight of 504.37 g/mol. Its IUPAC name is 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 23645531 |
| Molecular Formula | C16H17F9N2O4S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[benzyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NO)N(Cc1ccccc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F9N2O4S/c1-9(2)11(12(28)26-29)27(8-10-6-4-3-5-7-10)32(30,31)16(24,25)14(19,20)13(17,18)15(21,22)23/h3-7,9,11,29H,8H2,1-2H3,(H,26,28) |
| InChIKey | VLTOUUSTKONGKC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|