About (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide
(2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide (PubChem CID 23645888) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide |
| PubChem CID | 23645888 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide |
| SMILES | C[C@@H](C#N)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C10H19N3O/c1-7(6-11)13(5)9(14)8(12)10(2,3)4/h7-8H,12H2,1-5H3/t7-,8+/m0/s1 |
| InChIKey | KNARVBXGIRZZRK-JGVFFNPUSA-N |
| XLogP | 0.73 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide?
The IUPAC name of (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide (CID 23645888) is (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide.
What is the SMILES notation for (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide?
The canonical SMILES for (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide is C[C@@H](C#N)N(C)C(=O)[C@@H](N)C(C)(C)C.
What is the InChIKey of (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide?
The InChIKey is KNARVBXGIRZZRK-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H19N3O/c1-7(6-11)13(5)9(14)8(12)10(2,3)4/h7-8H,12H2,1-5H3/t7-,8+/m0/s1.
What are the key properties of (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide?
(2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide has a molecular weight of 197.28 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(1S)-1-cyanoethyl]-N,3,3-trimethylbutanamide is sourced from PubChem (CID 23645888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).