C19H19F7N4O — CID 23645927
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[2-methyl-3-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one (PubChem CID 23645927) has the molecular formula C19H19F7N4O and a molecular weight of 452.37 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[2-methyl-3-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[2-methyl-3-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 23645927 |
| Molecular Formula | C19H19F7N4O |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[2-methyl-3-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
| SMILES | Cn1nc2c(c1C(F)(F)C(F)(F)F)CN(C(=O)C[C@H](N)Cc1cc(F)ccc1F)CC2 |
| InChI | InChI=1S/C19H19F7N4O/c1-29-17(18(22,23)19(24,25)26)13-9-30(5-4-15(13)28-29)16(31)8-12(27)7-10-6-11(20)2-3-14(10)21/h2-3,6,12H,4-5,7-9,27H2,1H3/t12-/m1/s1 |
| InChIKey | UZZQTYSAGWOFHA-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|