C17H17F5N4O — CID 23645932
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(trifluoromethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]butan-1-one (PubChem CID 23645932) has the molecular formula C17H17F5N4O and a molecular weight of 388.34 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(trifluoromethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(trifluoromethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]butan-1-one |
|---|---|
| PubChem CID | 23645932 |
| Molecular Formula | C17H17F5N4O |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(trifluoromethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCc2c(C(F)(F)F)n[nH]c2C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H17F5N4O/c18-10-1-2-13(19)9(5-10)6-11(23)7-15(27)26-4-3-12-14(8-26)24-25-16(12)17(20,21)22/h1-2,5,11H,3-4,6-8,23H2,(H,24,25)/t11-/m1/s1 |
| InChIKey | KVRMYQSOYRIRJG-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |