C19H22F2N4O — CID 23645934
(3R)-3-amino-1-(3-cyclopropyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-4-(2,5-difluorophenyl)butan-1-one (PubChem CID 23645934) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is (3R)-3-amino-1-(3-cyclopropyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-4-(2,5-difluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-(3-cyclopropyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-4-(2,5-difluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 23645934 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3R)-3-amino-1-(3-cyclopropyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-4-(2,5-difluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCc2c(C3CC3)n[nH]c2C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C19H22F2N4O/c20-13-3-4-16(21)12(7-13)8-14(22)9-18(26)25-6-5-15-17(10-25)23-24-19(15)11-1-2-11/h3-4,7,11,14H,1-2,5-6,8-10,22H2,(H,23,24)/t14-/m1/s1 |
| InChIKey | WEALCGSKAOFUDP-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |