About N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide
N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide (PubChem CID 23645981) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide |
| PubChem CID | 23645981 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2n[nH]c3c2CN(C(C)=O)C3)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-9(20)19-7-12-13(8-19)17-18-14(12)16-15(21)10-3-5-11(22-2)6-4-10/h3-6H,7-8H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | WKUZSVHNZTYTJG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide?
The IUPAC name of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide (CID 23645981) is N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide.
What is the SMILES notation for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide?
The canonical SMILES for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide is COc1ccc(C(=O)Nc2n[nH]c3c2CN(C(C)=O)C3)cc1.
What is the InChIKey of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide?
The InChIKey is WKUZSVHNZTYTJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-9(20)19-7-12-13(8-19)17-18-14(12)16-15(21)10-3-5-11(22-2)6-4-10/h3-6H,7-8H2,1-2H3,(H2,16,17,18,21).
What are the key properties of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide?
N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide has a molecular weight of 300.32 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-4-methoxybenzamide is sourced from PubChem (CID 23645981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).