About N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide
N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide (PubChem CID 23645983) has the molecular formula C14H13FN4O2
and a molecular weight of 288.28 g/mol. Its IUPAC name is N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide |
| PubChem CID | 23645983 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide |
| SMILES | CC(=O)N1Cc2[nH]nc(NC(=O)c3cccc(F)c3)c2C1 |
| InChI | InChI=1S/C14H13FN4O2/c1-8(20)19-6-11-12(7-19)17-18-13(11)16-14(21)9-3-2-4-10(15)5-9/h2-5H,6-7H2,1H3,(H2,16,17,18,21) |
| InChIKey | OIGXEDXBMLAHJI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide?
The IUPAC name of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide (CID 23645983) is N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide.
What is the SMILES notation for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide?
The canonical SMILES for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide is CC(=O)N1Cc2[nH]nc(NC(=O)c3cccc(F)c3)c2C1.
What is the InChIKey of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide?
The InChIKey is OIGXEDXBMLAHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4O2/c1-8(20)19-6-11-12(7-19)17-18-13(11)16-14(21)9-3-2-4-10(15)5-9/h2-5H,6-7H2,1H3,(H2,16,17,18,21).
What are the key properties of N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide?
N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide has a molecular weight of 288.28 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)-3-fluorobenzamide is sourced from PubChem (CID 23645983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).