C18H22FN5O2 — CID 23645990
N-butyl-3-[[2-(2-fluorophenyl)acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 23645990) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is N-butyl-3-[[2-(2-fluorophenyl)acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | N-butyl-3-[[2-(2-fluorophenyl)acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 23645990 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-butyl-3-[[2-(2-fluorophenyl)acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)N1Cc2[nH]nc(NC(=O)Cc3ccccc3F)c2C1 |
| InChI | InChI=1S/C18H22FN5O2/c1-2-3-8-20-18(26)24-10-13-15(11-24)22-23-17(13)21-16(25)9-12-6-4-5-7-14(12)19/h4-7H,2-3,8-11H2,1H3,(H,20,26)(H2,21,22,23,25) |
| InChIKey | JRLCFYYHBUWFDK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|