C22H28N6O3 — CID 23645992
N-butyl-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 23645992) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-butyl-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | N-butyl-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 23645992 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-butyl-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)N1Cc2[nH]nc(NC(=O)Cc3ccc(N4CCCC4=O)cc3)c2C1 |
| InChI | InChI=1S/C22H28N6O3/c1-2-3-10-23-22(31)27-13-17-18(14-27)25-26-21(17)24-19(29)12-15-6-8-16(9-7-15)28-11-4-5-20(28)30/h6-9H,2-5,10-14H2,1H3,(H,23,31)(H2,24,25,26,29) |
| InChIKey | ACXFBDRQBQFLGH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|