C15H15N5O2 — CID 23646048
5-[(E)-methoxyiminomethyl]-6-(1-methylindol-5-yl)oxypyrimidin-4-amine (PubChem CID 23646048) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 5-[(E)-methoxyiminomethyl]-6-(1-methylindol-5-yl)oxypyrimidin-4-amine.
| Compound Name | 5-[(E)-methoxyiminomethyl]-6-(1-methylindol-5-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 23646048 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 5-[(E)-methoxyiminomethyl]-6-(1-methylindol-5-yl)oxypyrimidin-4-amine |
| SMILES | CO/N=C/c1c(N)ncnc1Oc1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C15H15N5O2/c1-20-6-5-10-7-11(3-4-13(10)20)22-15-12(8-19-21-2)14(16)17-9-18-15/h3-9H,1-2H3,(H2,16,17,18)/b19-8+ |
| InChIKey | HVNMIYOKZLTHNY-UFWORHAWSA-N |
| XLogP | 2.32 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|