About (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide
(2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide (PubChem CID 23646351) has the molecular formula C18H17N3OS
and a molecular weight of 323.42 g/mol. Its IUPAC name is (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide |
| PubChem CID | 23646351 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide |
| SMILES | C[C@H](N)C(=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H17N3OS/c1-12(19)17(22)21-18-20-15(13-8-4-2-5-9-13)16(23-18)14-10-6-3-7-11-14/h2-12H,19H2,1H3,(H,20,21,22)/t12-/m0/s1 |
| InChIKey | ACAHAYSKCDTFST-LBPRGKRZSA-N |
| XLogP | 3.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide?
The IUPAC name of (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide (CID 23646351) is (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide?
The canonical SMILES for (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide is C[C@H](N)C(=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1.
What is the InChIKey of (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide?
The InChIKey is ACAHAYSKCDTFST-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H17N3OS/c1-12(19)17(22)21-18-20-15(13-8-4-2-5-9-13)16(23-18)14-10-6-3-7-11-14/h2-12H,19H2,1H3,(H,20,21,22)/t12-/m0/s1.
What are the key properties of (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide?
(2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide has a molecular weight of 323.42 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(4,5-diphenyl-1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 23646351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).