C26H20F6N4O5S2 — CID 23646434
N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-2,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 23646434) has the molecular formula C26H20F6N4O5S2 and a molecular weight of 646.59 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-2,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-2,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23646434 |
| Molecular Formula | C26H20F6N4O5S2 |
| Molecular Weight | 646.59 g/mol |
| Exact Mass | 646.08 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-2,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1CC(c2ccc(C[C@H](NS(=O)(=O)c3cc(C(F)(F)F)ccc3C(F)(F)F)c3nc4ccccc4[nH]3)cc2)S(=O)(=O)N1 |
| InChI | InChI=1S/C26H20F6N4O5S2/c27-25(28,29)16-9-10-17(26(30,31)32)22(12-16)43(40,41)35-20(24-33-18-3-1-2-4-19(18)34-24)11-14-5-7-15(8-6-14)21-13-23(37)36-42(21,38)39/h1-10,12,20-21,35H,11,13H2,(H,33,34)(H,36,37)/t20-,21?/m0/s1 |
| InChIKey | YNNHORCPGCQELW-BGERDNNASA-N |
| XLogP | 4.75 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |