C17H18F5N5O — CID 23646441
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[(8R)-8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one (PubChem CID 23646441) has the molecular formula C17H18F5N5O and a molecular weight of 403.36 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[(8R)-8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[(8R)-8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one |
|---|---|
| PubChem CID | 23646441 |
| Molecular Formula | C17H18F5N5O |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[(8R)-8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one |
| SMILES | C[C@@H]1c2nnc(C(F)(F)F)n2CCN1C(=O)C[C@H](N)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H18F5N5O/c1-9-15-24-25-16(17(20,21)22)27(15)5-4-26(9)14(28)8-12(23)7-10-6-11(18)2-3-13(10)19/h2-3,6,9,12H,4-5,7-8,23H2,1H3/t9-,12-/m1/s1 |
| InChIKey | PLKMQHKMKGBMFQ-BXKDBHETSA-N |
| XLogP | 2.44 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |