About 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide
4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide (PubChem CID 23646461) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide |
| PubChem CID | 23646461 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C18H23N3O2/c1-3-22-16-10-5-13(11-17(16)23-4-2)12-21-15-8-6-14(7-9-15)18(19)20/h5-11,21H,3-4,12H2,1-2H3,(H3,19,20) |
| InChIKey | KWXVDUACPKJCCN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide?
The IUPAC name of 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide (CID 23646461) is 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide.
What is the SMILES notation for 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide?
The canonical SMILES for 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide is [H]/N=C(\N)c1ccc(NCc2ccc(OCC)c(OCC)c2)cc1.
What is the InChIKey of 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide?
The InChIKey is KWXVDUACPKJCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-3-22-16-10-5-13(11-17(16)23-4-2)12-21-15-8-6-14(7-9-15)18(19)20/h5-11,21H,3-4,12H2,1-2H3,(H3,19,20).
What are the key properties of 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide?
4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide has a molecular weight of 313.40 g/mol, XLogP of 3.38, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide is sourced from PubChem (CID 23646461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).