C33H42N4O10S — CID 23646552
2-[4-[2-acetamido-3-[[5-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 23646552) has the molecular formula C33H42N4O10S and a molecular weight of 686.78 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-[[5-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-[[5-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 23646552 |
| Molecular Formula | C33H42N4O10S |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | 2-[4-[2-acetamido-3-[[5-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCC(=O)N[C@@H](CCSC)C(=O)OC)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C33H42N4O10S/c1-5-22-18-21(13-14-26(22)37(30(41)32(44)45)27-11-7-6-10-23(27)31(42)43)19-25(35-20(2)38)29(40)34-16-9-8-12-28(39)36-24(15-17-48-4)33(46)47-3/h6-7,10-11,13-14,18,24-25H,5,8-9,12,15-17,19H2,1-4H3,(H,34,40)(H,35,38)(H,36,39)(H,42,43)(H,44,45)/t24-,25?/m0/s1 |
| InChIKey | UMSOBSQPENLMAP-SKCDSABHSA-N |
| XLogP | 2.44 |
| TPSA | 208.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|