C28H37N7O3S — CID 23646593
(2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methyl-2-[[(2R)-2-(methylamino)-3-phenylpropanoyl]amino]butanamide (PubChem CID 23646593) has the molecular formula C28H37N7O3S and a molecular weight of 551.72 g/mol. Its IUPAC name is (2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methyl-2-[[(2R)-2-(methylamino)-3-phenylpropanoyl]amino]butanamide.
| Compound Name | (2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methyl-2-[[(2R)-2-(methylamino)-3-phenylpropanoyl]amino]butanamide |
|---|---|
| PubChem CID | 23646593 |
| Molecular Formula | C28H37N7O3S |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methyl-2-[[(2R)-2-(methylamino)-3-phenylpropanoyl]amino]butanamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N[C@H](C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C28H37N7O3S/c1-17(2)23(35-25(37)21(31-3)16-18-10-5-4-6-11-18)26(38)33-20(13-9-15-32-28(29)30)24(36)27-34-19-12-7-8-14-22(19)39-27/h4-8,10-12,14,17,20-21,23,31H,9,13,15-16H2,1-3H3,(H,33,38)(H,35,37)(H4,29,30,32)/t20?,21-,23+/m1/s1 |
| InChIKey | KRHCNQAFUSINQB-VBFAWGIDSA-N |
| XLogP | 1.99 |
| TPSA | 164.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|