C26H35N7O3 — CID 23646597
(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-pyridin-2-ylpentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 23646597) has the molecular formula C26H35N7O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-pyridin-2-ylpentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-pyridin-2-ylpentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23646597 |
| Molecular Formula | C26H35N7O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-pyridin-2-ylpentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1ccccn1 |
| InChI | InChI=1S/C26H35N7O3/c1-29-21(17-18-9-3-2-4-10-18)25(36)33-16-8-13-22(33)24(35)32-20(12-7-15-31-26(27)28)23(34)19-11-5-6-14-30-19/h2-6,9-11,14,20-22,29H,7-8,12-13,15-17H2,1H3,(H,32,35)(H4,27,28,31)/t20?,21-,22+/m1/s1 |
| InChIKey | MUPVIGHETAMQEU-PDQYLBCOSA-N |
| XLogP | 0.62 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|