C28H36N8O3 — CID 23646599
(2S)-N-[1-(1H-benzimidazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 23646599) has the molecular formula C28H36N8O3 and a molecular weight of 532.65 g/mol. Its IUPAC name is (2S)-N-[1-(1H-benzimidazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(1H-benzimidazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23646599 |
| Molecular Formula | C28H36N8O3 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (2S)-N-[1-(1H-benzimidazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H36N8O3/c1-31-22(17-18-9-3-2-4-10-18)27(39)36-16-8-14-23(36)26(38)35-21(13-7-15-32-28(29)30)24(37)25-33-19-11-5-6-12-20(19)34-25/h2-6,9-12,21-23,31H,7-8,13-17H2,1H3,(H,33,34)(H,35,38)(H4,29,30,32)/t21?,22-,23+/m1/s1 |
| InChIKey | DPKBODMBRLVNFI-NRSZHQCHSA-N |
| XLogP | 1.11 |
| TPSA | 171.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|