C29H38N8O3 — CID 23646600
(2S)-N-[5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 23646600) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is (2S)-N-[5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23646600 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2S)-N-[5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2n1C |
| InChI | InChI=1S/C29H38N8O3/c1-32-22(18-19-10-4-3-5-11-19)28(40)37-17-9-15-24(37)27(39)35-21(13-8-16-33-29(30)31)25(38)26-34-20-12-6-7-14-23(20)36(26)2/h3-7,10-12,14,21-22,24,32H,8-9,13,15-18H2,1-2H3,(H,35,39)(H4,30,31,33)/t21?,22-,24+/m1/s1 |
| InChIKey | QMYCSIPHSWKVGL-MKXPUETBSA-N |
| XLogP | 1.12 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|