C32H37N7O3S — CID 23646607
(2S)-N-[1-benzo[g][1,3]benzothiazol-2-yl-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 23646607) has the molecular formula C32H37N7O3S and a molecular weight of 599.76 g/mol. Its IUPAC name is (2S)-N-[1-benzo[g][1,3]benzothiazol-2-yl-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-benzo[g][1,3]benzothiazol-2-yl-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23646607 |
| Molecular Formula | C32H37N7O3S |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | (2S)-N-[1-benzo[g][1,3]benzothiazol-2-yl-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccc3ccccc3c2s1 |
| InChI | InChI=1S/C32H37N7O3S/c1-35-25(19-20-9-3-2-4-10-20)31(42)39-18-8-14-26(39)29(41)37-23(13-7-17-36-32(33)34)27(40)30-38-24-16-15-21-11-5-6-12-22(21)28(24)43-30/h2-6,9-12,15-16,23,25-26,35H,7-8,13-14,17-19H2,1H3,(H,37,41)(H4,33,34,36)/t23?,25-,26+/m1/s1 |
| InChIKey | MKMDZUXFZBUTJY-MGURPGMTSA-N |
| XLogP | 2.99 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|