C29H37N7O4S — CID 23646611
(2S)-N-[5-(diaminomethylideneamino)-1-[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 23646611) has the molecular formula C29H37N7O4S and a molecular weight of 579.73 g/mol. Its IUPAC name is (2S)-N-[5-(diaminomethylideneamino)-1-[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(diaminomethylideneamino)-1-[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23646611 |
| Molecular Formula | C29H37N7O4S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | (2S)-N-[5-(diaminomethylideneamino)-1-[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccc(CO)cc2s1 |
| InChI | InChI=1S/C29H37N7O4S/c1-32-22(15-18-7-3-2-4-8-18)28(40)36-14-6-10-23(36)26(39)34-21(9-5-13-33-29(30)31)25(38)27-35-20-12-11-19(17-37)16-24(20)41-27/h2-4,7-8,11-12,16,21-23,32,37H,5-6,9-10,13-15,17H2,1H3,(H,34,39)(H4,30,31,33)/t21?,22-,23+/m1/s1 |
| InChIKey | JOZFYQFQVKXWOD-NRSZHQCHSA-N |
| XLogP | 1.33 |
| TPSA | 176.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|