C22H27N5O2S — CID 23646628
7-cyclohexyl-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 23646628) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 7-cyclohexyl-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclohexyl-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 23646628 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 7-cyclohexyl-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | O=S1(=O)CCN(c2ccc(Nc3ncc4ccn(C5CCCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O2S/c28-30(29)14-12-26(13-15-30)19-8-6-18(7-9-19)24-22-23-16-17-10-11-27(21(17)25-22)20-4-2-1-3-5-20/h6-11,16,20H,1-5,12-15H2,(H,23,24,25) |
| InChIKey | FNDDITSMOQUAJX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|