C15H14BrNO5S — CID 23646669
4-bromo-3-(carboxymethoxy)-5-[4-(dimethylamino)phenyl]thiophene-2-carboxylic acid (PubChem CID 23646669) has the molecular formula C15H14BrNO5S and a molecular weight of 400.25 g/mol. Its IUPAC name is 4-bromo-3-(carboxymethoxy)-5-[4-(dimethylamino)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-3-(carboxymethoxy)-5-[4-(dimethylamino)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 23646669 |
| Molecular Formula | C15H14BrNO5S |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 4-bromo-3-(carboxymethoxy)-5-[4-(dimethylamino)phenyl]thiophene-2-carboxylic acid |
| SMILES | CN(C)c1ccc(-c2sc(C(=O)O)c(OCC(=O)O)c2Br)cc1 |
| InChI | InChI=1S/C15H14BrNO5S/c1-17(2)9-5-3-8(4-6-9)13-11(16)12(22-7-10(18)19)14(23-13)15(20)21/h3-6H,7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VSRQARFUSCWMHO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |