C30H22N4 — CID 23646778
4-[(5-{[5-(naphthalen-1-yl)-1H-indol-1-yl]methyl}-1H-imidazol-1-yl)methyl]benzonitrile (PubChem CID 23646778) has the molecular formula C30H22N4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 4-[[5-[(5-naphthalen-1-ylindol-1-yl)methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[(5-{[5-(naphthalen-1-yl)-1H-indol-1-yl]methyl}-1H-imidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 23646778 |
| Molecular Formula | C30H22N4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-[[5-[(5-naphthalen-1-ylindol-1-yl)methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC4=C(C=C3)N(C=C4)CC5=CN=CN5CC6=CC=C(C=C6)C#N |
| InChI | InChI=1S/C30H22N4/c31-17-22-8-10-23(11-9-22)19-34-21-32-18-27(34)20-33-15-14-26-16-25(12-13-30(26)33)29-7-3-5-24-4-1-2-6-28(24)29/h1-16,18,21H,19-20H2 |
| InChIKey | GMRZSXNEOIVFAA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | 721 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |