About ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate
ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 23646847) has the molecular formula C14H14N4O6
and a molecular weight of 334.29 g/mol. Its IUPAC name is ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate |
| PubChem CID | 23646847 |
| Molecular Formula | C14H14N4O6 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H14N4O6/c1-4-24-14(19)13-8(2)15-16(9(13)3)11-6-5-10(17(20)21)7-12(11)18(22)23/h5-7H,4H2,1-3H3 |
| InChIKey | SKRFJKMTUIWARN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate?
The IUPAC name of ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate (CID 23646847) is ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate is CCOC(=O)c1c(C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C.
What is the InChIKey of ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate?
The InChIKey is SKRFJKMTUIWARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O6/c1-4-24-14(19)13-8(2)15-16(9(13)3)11-6-5-10(17(20)21)7-12(11)18(22)23/h5-7H,4H2,1-3H3.
What are the key properties of ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate?
ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate has a molecular weight of 334.29 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dinitrophenyl)-3,5-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 23646847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).