C26H28N4O2 — CID 23646853
1-[[3-[2-hydroxy-3-(1H-pyrrolo[3,2-c]pyridin-2-yl)phenyl]phenyl]methyl]-3-pentylurea (PubChem CID 23646853) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[[3-[2-hydroxy-3-(1H-pyrrolo[3,2-c]pyridin-2-yl)phenyl]phenyl]methyl]-3-pentylurea.
| Compound Name | 1-[[3-[2-hydroxy-3-(1H-pyrrolo[3,2-c]pyridin-2-yl)phenyl]phenyl]methyl]-3-pentylurea |
|---|---|
| PubChem CID | 23646853 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[[3-[2-hydroxy-3-(1H-pyrrolo[3,2-c]pyridin-2-yl)phenyl]phenyl]methyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCc1cccc(-c2cccc(-c3cc4cnccc4[nH]3)c2O)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-2-3-4-12-28-26(32)29-16-18-7-5-8-19(14-18)21-9-6-10-22(25(21)31)24-15-20-17-27-13-11-23(20)30-24/h5-11,13-15,17,30-31H,2-4,12,16H2,1H3,(H2,28,29,32) |
| InChIKey | XTAHGKQMINKGEH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|