C18H15ClF2N4S — CID 23647104
(3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-thiophen-3-ylpyrimidin-4-yl)pyrrolidin-3-amine (PubChem CID 23647104) has the molecular formula C18H15ClF2N4S and a molecular weight of 392.86 g/mol. Its IUPAC name is (3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-thiophen-3-ylpyrimidin-4-yl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-thiophen-3-ylpyrimidin-4-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 23647104 |
| Molecular Formula | C18H15ClF2N4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-thiophen-3-ylpyrimidin-4-yl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CN(c2cc(-c3ccsc3)ncn2)C[C@@H]1c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H15ClF2N4S/c19-13-4-15(21)14(20)3-11(13)12-6-25(7-16(12)22)18-5-17(23-9-24-18)10-1-2-26-8-10/h1-5,8-9,12,16H,6-7,22H2/t12-,16+/m1/s1 |
| InChIKey | QWUWSZCVPDEKJJ-WBMJQRKESA-N |
| XLogP | 4.07 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|