C23H22F3N5O — CID 23647109
3-[6-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-4-yl]-N,N-dimethylbenzamide (PubChem CID 23647109) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is 3-[6-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-4-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[6-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-4-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 23647109 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-[6-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-4-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2cc(N3C[C@H](c4cc(F)c(F)cc4F)[C@@H](N)C3)ncn2)c1 |
| InChI | InChI=1S/C23H22F3N5O/c1-30(2)23(32)14-5-3-4-13(6-14)21-9-22(29-12-28-21)31-10-16(20(27)11-31)15-7-18(25)19(26)8-17(15)24/h3-9,12,16,20H,10-11,27H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | LUCRWOVIRFVMSM-UZLBHIALSA-N |
| XLogP | 3.19 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|