C24H24F3N5O3S — CID 23647110
(3R,4S)-1-[6-(3-morpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 23647110) has the molecular formula C24H24F3N5O3S and a molecular weight of 519.55 g/mol. Its IUPAC name is (3R,4S)-1-[6-(3-morpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-[6-(3-morpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 23647110 |
| Molecular Formula | C24H24F3N5O3S |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (3R,4S)-1-[6-(3-morpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CN(c2cc(-c3cccc(S(=O)(=O)N4CCOCC4)c3)ncn2)C[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H24F3N5O3S/c25-19-10-21(27)20(26)9-17(19)18-12-31(13-22(18)28)24-11-23(29-14-30-24)15-2-1-3-16(8-15)36(33,34)32-4-6-35-7-5-32/h1-3,8-11,14,18,22H,4-7,12-13,28H2/t18-,22+/m1/s1 |
| InChIKey | SDCAYDSIXAYUNR-GCJKJVERSA-N |
| XLogP | 2.51 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|