C21H18F4N4O2S — CID 23647111
(3R,4S)-1-[6-(3-fluoro-5-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 23647111) has the molecular formula C21H18F4N4O2S and a molecular weight of 466.46 g/mol. Its IUPAC name is (3R,4S)-1-[6-(3-fluoro-5-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-[6-(3-fluoro-5-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 23647111 |
| Molecular Formula | C21H18F4N4O2S |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (3R,4S)-1-[6-(3-fluoro-5-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | CS(=O)(=O)c1cc(F)cc(-c2cc(N3C[C@H](c4cc(F)c(F)cc4F)[C@@H](N)C3)ncn2)c1 |
| InChI | InChI=1S/C21H18F4N4O2S/c1-32(30,31)13-3-11(2-12(22)4-13)20-7-21(28-10-27-20)29-8-15(19(26)9-29)14-5-17(24)18(25)6-16(14)23/h2-7,10,15,19H,8-9,26H2,1H3/t15-,19+/m1/s1 |
| InChIKey | UBXGPYOGZWQEDB-BEFAXECRSA-N |
| XLogP | 3.03 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|