C19H24F3N5 — CID 23647113
6-[(3S,4S)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-N,N-diethylpyrimidin-4-amine (PubChem CID 23647113) has the molecular formula C19H24F3N5 and a molecular weight of 379.43 g/mol. Its IUPAC name is 6-[(3S,4S)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-N,N-diethylpyrimidin-4-amine.
| Compound Name | 6-[(3S,4S)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-N,N-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23647113 |
| Molecular Formula | C19H24F3N5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 6-[(3S,4S)-3-amino-4-(2,4,5-trifluorophenyl)piperidin-1-yl]-N,N-diethylpyrimidin-4-amine |
| SMILES | CCN(CC)c1cc(N2CC[C@@H](c3cc(F)c(F)cc3F)[C@H](N)C2)ncn1 |
| InChI | InChI=1S/C19H24F3N5/c1-3-26(4-2)18-9-19(25-11-24-18)27-6-5-12(17(23)10-27)13-7-15(21)16(22)8-14(13)20/h7-9,11-12,17H,3-6,10,23H2,1-2H3/t12-,17+/m0/s1 |
| InChIKey | JWVSSECKHRQANG-YVEFUNNKSA-N |
| XLogP | 3.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|