C17H22F3N3O2 — CID 23647118
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,3-dimethyl-1,4-diazepan-2-one (PubChem CID 23647118) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,3-dimethyl-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,3-dimethyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647118 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,3-dimethyl-1,4-diazepan-2-one |
| SMILES | C[C@@H]1C(=O)N(C)CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3N3O2/c1-10-17(25)22(2)4-3-5-23(10)16(24)8-12(21)6-11-7-14(19)15(20)9-13(11)18/h7,9-10,12H,3-6,8,21H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | YPZLSXIJVRUOKV-ZYHUDNBSSA-N |
| XLogP | 1.44 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|