C18H24F3N3O3 — CID 23647119
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-hydroxyethyl)-3-methyl-1,4-diazepan-2-one (PubChem CID 23647119) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-hydroxyethyl)-3-methyl-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-hydroxyethyl)-3-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647119 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-hydroxyethyl)-3-methyl-1,4-diazepan-2-one |
| SMILES | C[C@@H]1C(=O)N(CCO)CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H24F3N3O3/c1-11-18(27)23(5-6-25)3-2-4-24(11)17(26)9-13(22)7-12-8-15(20)16(21)10-14(12)19/h8,10-11,13,25H,2-7,9,22H2,1H3/t11-,13-/m1/s1 |
| InChIKey | HTSLDXVXLFGMNX-DGCLKSJQSA-N |
| XLogP | 0.81 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|