C25H30F3N3O3 — CID 23647120
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-(2-phenylmethoxyethyl)-1,4-diazepan-2-one (PubChem CID 23647120) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-(2-phenylmethoxyethyl)-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-(2-phenylmethoxyethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647120 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-(2-phenylmethoxyethyl)-1,4-diazepan-2-one |
| SMILES | C[C@@H]1C(=O)N(CCOCc2ccccc2)CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H30F3N3O3/c1-17-25(33)30(10-11-34-16-18-6-3-2-4-7-18)8-5-9-31(17)24(32)14-20(29)12-19-13-22(27)23(28)15-21(19)26/h2-4,6-7,13,15,17,20H,5,8-12,14,16,29H2,1H3/t17-,20-/m1/s1 |
| InChIKey | NCQYCDSSEAOFGA-YLJYHZDGSA-N |
| XLogP | 3.03 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|