C18H24F3N3O2 — CID 23647126
(3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-ethyl-6-methyl-1,4-diazepan-2-one (PubChem CID 23647126) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-ethyl-6-methyl-1,4-diazepan-2-one.
| Compound Name | (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-ethyl-6-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647126 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-ethyl-6-methyl-1,4-diazepan-2-one |
| SMILES | CC[C@@H]1C(=O)NC[C@@H](C)CN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H24F3N3O2/c1-3-16-18(26)23-8-10(2)9-24(16)17(25)6-12(22)4-11-5-14(20)15(21)7-13(11)19/h5,7,10,12,16H,3-4,6,8-9,22H2,1-2H3,(H,23,26)/t10-,12-,16-/m1/s1 |
| InChIKey | GTZPAVVEMVRYBF-NSODJVPESA-N |
| XLogP | 1.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|