C22H25F3N4O2 — CID 23647130
(3R,7R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-7-methyl-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one (PubChem CID 23647130) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is (3R,7R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-7-methyl-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one.
| Compound Name | (3R,7R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-7-methyl-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647130 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (3R,7R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-7-methyl-3-(pyridin-2-ylmethyl)-1,4-diazepan-2-one |
| SMILES | C[C@@H]1CCN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)[C@H](Cc2ccccn2)C(=O)N1 |
| InChI | InChI=1S/C22H25F3N4O2/c1-13-5-7-29(20(22(31)28-13)11-16-4-2-3-6-27-16)21(30)10-15(26)8-14-9-18(24)19(25)12-17(14)23/h2-4,6,9,12-13,15,20H,5,7-8,10-11,26H2,1H3,(H,28,31)/t13-,15-,20-/m1/s1 |
| InChIKey | ZFZQVFBOAKOERI-WAWZGNHOSA-N |
| XLogP | 2.11 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|