C27H30F5N3O5 — CID 23647135
(2S)-2-[4-[[[(2S)-1-[(3R)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoyl]pyrrolidine-2-carbonyl]amino]methyl]phenoxy]-3-methylbutanoic acid (PubChem CID 23647135) has the molecular formula C27H30F5N3O5 and a molecular weight of 571.54 g/mol. Its IUPAC name is (2S)-2-[4-[[[(2S)-1-[(3R)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoyl]pyrrolidine-2-carbonyl]amino]methyl]phenoxy]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[4-[[[(2S)-1-[(3R)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoyl]pyrrolidine-2-carbonyl]amino]methyl]phenoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23647135 |
| Molecular Formula | C27H30F5N3O5 |
| Molecular Weight | 571.54 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (2S)-2-[4-[[[(2S)-1-[(3R)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoyl]pyrrolidine-2-carbonyl]amino]methyl]phenoxy]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](Oc1ccc(CNC(=O)[C@@H]2CCCN2C(=O)C[C@H](N)Cc2c(F)c(F)c(F)c(F)c2F)cc1)C(=O)O |
| InChI | InChI=1S/C27H30F5N3O5/c1-13(2)25(27(38)39)40-16-7-5-14(6-8-16)12-34-26(37)18-4-3-9-35(18)19(36)11-15(33)10-17-20(28)22(30)24(32)23(31)21(17)29/h5-8,13,15,18,25H,3-4,9-12,33H2,1-2H3,(H,34,37)(H,38,39)/t15-,18+,25+/m1/s1 |
| InChIKey | MAKUSAJTXWUWHK-DZQNVJDRSA-N |
| XLogP | 3.44 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|