C19H19F6N5O — CID 23647146
2-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pent-4-en-1-one (PubChem CID 23647146) has the molecular formula C19H19F6N5O and a molecular weight of 447.38 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pent-4-en-1-one.
| Compound Name | 2-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 23647146 |
| Molecular Formula | C19H19F6N5O |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pent-4-en-1-one |
| SMILES | C=CCC(C(=O)N1CCn2c(nnc2C(F)(F)F)C1)[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H19F6N5O/c1-2-3-11(15(26)7-10-6-13(21)14(22)8-12(10)20)17(31)29-4-5-30-16(9-29)27-28-18(30)19(23,24)25/h2,6,8,11,15H,1,3-5,7,9,26H2/t11?,15-/m1/s1 |
| InChIKey | IBMCNISGWCTXGJ-JOPIAHFSSA-N |
| XLogP | 2.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|