C27H31N3O9 — CID 23647192
2-[4-[2-acetamido-3-(4-carboxybutylamino)-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 23647192) has the molecular formula C27H31N3O9 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-(4-carboxybutylamino)-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-(4-carboxybutylamino)-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 23647192 |
| Molecular Formula | C27H31N3O9 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[4-[2-acetamido-3-(4-carboxybutylamino)-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCC(=O)O)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C27H31N3O9/c1-3-18-14-17(15-20(29-16(2)31)24(34)28-13-7-6-10-23(32)33)11-12-21(18)30(25(35)27(38)39)22-9-5-4-8-19(22)26(36)37/h4-5,8-9,11-12,14,20H,3,6-7,10,13,15H2,1-2H3,(H,28,34)(H,29,31)(H,32,33)(H,36,37)(H,38,39) |
| InChIKey | LENUCMQPYJPVKQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 190.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|