About 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid
4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid (PubChem CID 23647303) has the molecular formula C20H15F2NO4S
and a molecular weight of 403.41 g/mol. Its IUPAC name is 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid |
| PubChem CID | 23647303 |
| Molecular Formula | C20H15F2NO4S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid |
| SMILES | CCOc1ccccc1-c1cc(F)c(NC(=O)c2cscc2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H15F2NO4S/c1-2-27-17-6-4-3-5-12(17)11-7-15(21)18(16(22)8-11)23-19(24)13-9-28-10-14(13)20(25)26/h3-10H,2H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | YREPFJJQSHIGEQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid?
The IUPAC name of 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid (CID 23647303) is 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid.
What is the SMILES notation for 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid?
The canonical SMILES for 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid is CCOc1ccccc1-c1cc(F)c(NC(=O)c2cscc2C(=O)O)c(F)c1.
What is the InChIKey of 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid?
The InChIKey is YREPFJJQSHIGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2NO4S/c1-2-27-17-6-4-3-5-12(17)11-7-15(21)18(16(22)8-11)23-19(24)13-9-28-10-14(13)20(25)26/h3-10H,2H2,1H3,(H,23,24)(H,25,26).
What are the key properties of 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid?
4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid has a molecular weight of 403.41 g/mol, XLogP of 5.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2-ethoxyphenyl)-2,6-difluorophenyl]carbamoyl]thiophene-3-carboxylic acid is sourced from PubChem (CID 23647303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).