About Imidazole 81
Imidazole 81 (PubChem CID 23647350) has the molecular formula C18H15F2N5
and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-[5-(2,5-difluorophenyl)-1H-imidazol-4-yl]-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | Imidazole 81 |
| PubChem CID | 23647350 |
| Molecular Formula | C18H15F2N5 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6-[5-(2,5-difluorophenyl)-1H-imidazol-4-yl]-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)C1=NN=C2N1C=C(C=C2)C3=C(NC=N3)C4=C(C=CC(=C4)F)F |
| InChI | InChI=1S/C18H15F2N5/c1-10(2)18-24-23-15-6-3-11(8-25(15)18)16-17(22-9-21-16)13-7-12(19)4-5-14(13)20/h3-10H,1-2H3,(H,21,22) |
| InChIKey | UIQOOHLUHZGTBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | 465 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Imidazole 81 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Imidazole 81?
The IUPAC name of Imidazole 81 (CID 23647350) is 6-[5-(2,5-difluorophenyl)-1H-imidazol-4-yl]-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for Imidazole 81?
The canonical SMILES for Imidazole 81 is CC(C)C1=NN=C2N1C=C(C=C2)C3=C(NC=N3)C4=C(C=CC(=C4)F)F.
What is the InChIKey of Imidazole 81?
The InChIKey is UIQOOHLUHZGTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2N5/c1-10(2)18-24-23-15-6-3-11(8-25(15)18)16-17(22-9-21-16)13-7-12(19)4-5-14(13)20/h3-10H,1-2H3,(H,21,22).
What are the key properties of Imidazole 81?
Imidazole 81 has a molecular weight of 339.30 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Imidazole 81 is sourced from PubChem (CID 23647350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).