C25H34F3N5O3S — CID 23647388
N-[(2S,3S)-3-amino-6,6,6-trifluoro-1-phenylhexan-2-yl]-2-[[(1S,2S)-2-methylcyclopropyl]methylamino]-6-[methyl(methylsulfonyl)amino]pyridine-4-carboxamide (PubChem CID 23647388) has the molecular formula C25H34F3N5O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is N-[(2S,3S)-3-amino-6,6,6-trifluoro-1-phenylhexan-2-yl]-2-[[(1S,2S)-2-methylcyclopropyl]methylamino]-6-[methyl(methylsulfonyl)amino]pyridine-4-carboxamide.
| Compound Name | N-[(2S,3S)-3-amino-6,6,6-trifluoro-1-phenylhexan-2-yl]-2-[[(1S,2S)-2-methylcyclopropyl]methylamino]-6-[methyl(methylsulfonyl)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 23647388 |
| Molecular Formula | C25H34F3N5O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-[(2S,3S)-3-amino-6,6,6-trifluoro-1-phenylhexan-2-yl]-2-[[(1S,2S)-2-methylcyclopropyl]methylamino]-6-[methyl(methylsulfonyl)amino]pyridine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H]1CNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](N)CCC(F)(F)F)cc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C25H34F3N5O3S/c1-16-11-19(16)15-30-22-13-18(14-23(32-22)33(2)37(3,35)36)24(34)31-21(12-17-7-5-4-6-8-17)20(29)9-10-25(26,27)28/h4-8,13-14,16,19-21H,9-12,15,29H2,1-3H3,(H,30,32)(H,31,34)/t16-,19+,20-,21-/m0/s1 |
| InChIKey | XVKYVWUBZDDZMH-CZGNIMDHSA-N |
| XLogP | 3.56 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |